CAS 915923-20-5

5-[[(4-Methylphenyl)thio]methyl]-2-furancarboxylic acid

Description:

5-[[(4-Methylphenyl)thio]methyl]-2-furancarboxylic acid, with the CAS number 915923-20-5, is an organic compound characterized by its unique structure that includes a furan ring, a carboxylic acid functional group, and a thioether linkage to a 4-methylphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and acid-base reactions. The thioether moiety may influence its solubility and reactivity, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry for its biological activity. The presence of the furan ring suggests potential applications in materials science and pharmaceuticals, as furan derivatives are often explored for their diverse chemical properties. Overall, this compound's characteristics make it a subject of interest for further research and application in various chemical fields.

Formula: C₁₃H₁₂O₃S

InChI: InChI=1S/C13H12O3S/c1-9-2-5-11(6-3-9)17-8-10-4-7-12(16-10)13(14)15/h2-7H,8H2,1H3,(H,14,15)

InChI key: InChIKey=YVVQCTVUNAOQNE-UHFFFAOYSA-N

SMILES: C(SC1=CC=C(C)C=C1)C=2OC(C(O)=O)=CC2

Synonyms:

• 2-Furancarboxylic acid, 5-[[(4-methylphenyl)thio]methyl]-
• 5-[[(4-Methylphenyl)thio]methyl]-2-furancarboxylic acid

5-{[(4-methylphenyl)thio]methyl}-2-furoic acid

CAS: 915923-20-5

Formula: C₁₃H₁₂O₃S

Purity: 95.0%

Molecular weight: 248.3

Ref: 10-F316004