CymitQuimica logo

CAS 915923-22-7

:

3-(o-tolylmethylamino)benzoic acid

Description:
3-(o-Tolylmethylamino)benzoic acid, identified by its CAS number 915923-22-7, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and an o-tolylmethylamino group. This compound features a carboxylic acid functional group (-COOH) that contributes to its acidic properties, making it soluble in polar solvents. The presence of the o-tolylmethylamino group enhances its potential for biological activity, possibly influencing its interaction with various biological targets. The compound's molecular structure suggests it may exhibit properties such as moderate lipophilicity due to the aromatic rings, which can affect its pharmacokinetics and bioavailability. Additionally, the specific arrangement of substituents can lead to unique reactivity patterns, making it of interest in medicinal chemistry and drug design. Overall, 3-(o-tolylmethylamino)benzoic acid is a compound that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C15H15NO2
InChI:InChI=1/C15H15NO2/c1-11-5-2-3-6-13(11)10-16-14-8-4-7-12(9-14)15(17)18/h2-9,16H,10H2,1H3,(H,17,18)
SMILES:Cc1ccccc1CNc1cccc(c1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.