CAS 915923-23-8

N-[(3-methyl-2-pyridyl)methyl]propan-2-amine

Description:

N-[(3-methyl-2-pyridyl)methyl]propan-2-amine, identified by its CAS number 915923-23-8, is a chemical compound characterized by its structure, which includes a propan-2-amine backbone substituted with a 3-methyl-2-pyridyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The pyridine ring contributes to its aromatic characteristics and may influence its solubility and reactivity. The presence of the methyl group on the pyridine ring can affect the steric and electronic properties of the molecule, potentially impacting its biological activity and interactions with other substances. Compounds like this may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential biological activity. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise values.

Formula: C₁₀H₁₆N₂

InChI: InChI=1/C10H16N2/c1-8(2)12-7-10-9(3)5-4-6-11-10/h4-6,8,12H,7H2,1-3H3

SMILES: CC(C)NCc1c(C)cccn1

N-[(3-methylpyridin-2-yl)methyl]propan-2-amine

CAS: 915923-23-8

Formula: C₁₀H₁₆N₂

Purity: 95.0%

Molecular weight: 164.252

Ref: 10-F308832