CymitQuimica logo

CAS 915923-25-0

:

(1-isobutyl-4-piperidyl)methanol

Description:
(1-Isobutyl-4-piperidyl)methanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of an isobutyl group contributes to its hydrophobic characteristics, while the methanol functional group introduces a hydroxyl (-OH) moiety, enhancing its potential for hydrogen bonding. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the hydroxyl group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine ring is often found in various bioactive compounds. The compound may exhibit specific biological activities, but detailed studies would be necessary to elucidate its pharmacological properties. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H21NO
InChI:InChI=1/C10H21NO/c1-9(2)7-11-5-3-10(8-12)4-6-11/h9-10,12H,3-8H2,1-2H3
SMILES:CC(C)CN1CCC(CC1)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.