CAS 915923-33-0

N-Ethyl-5-methyl-1,2,4-oxadiazole-3-methanamine

Description:

N-Ethyl-5-methyl-1,2,4-oxadiazole-3-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an ethyl group and a methyl group, contributing to its unique properties and reactivity. The presence of the methanamine functional group indicates that it has an amine component, which can participate in hydrogen bonding and nucleophilic reactions. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Its specific physical and chemical properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which could be relevant for applications in materials science or organic electronics.

Formula: C₆H₁₁N₃O

InChI: InChI=1S/C6H11N3O/c1-3-7-4-6-8-5(2)10-9-6/h7H,3-4H2,1-2H3

InChI key: InChIKey=DZHVDMGWCAAKHK-UHFFFAOYSA-N

SMILES: C(NCC)C=1N=C(C)ON1

Synonyms:

• N-Ethyl-5-methyl-1,2,4-oxadiazole-3-methanamine
• 1,2,4-Oxadiazole-3-methanamine, N-ethyl-5-methyl-