CAS 915923-34-1
:2-(3-chlorophenoxy)-N-ethyl-ethanamine
Description:
2-(3-chlorophenoxy)-N-ethyl-ethanamine, identified by its CAS number 915923-34-1, is a chemical compound characterized by its unique structure, which includes a chlorophenoxy group and an ethylamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the 3-chlorophenoxy group may impart specific biological activities or interactions, making it of interest in pharmaceutical research. Additionally, the chlorinated aromatic ring can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and bioavailability. The compound's reactivity may also be influenced by the electron-withdrawing nature of the chlorine atom, which can affect its interaction with other chemical species. Overall, 2-(3-chlorophenoxy)-N-ethyl-ethanamine is a compound of interest in medicinal chemistry, with potential applications in drug development and research into its biological effects.
Formula:C10H14ClNO
InChI:InChI=1/C10H14ClNO/c1-2-12-6-7-13-10-5-3-4-9(11)8-10/h3-5,8,12H,2,6-7H2,1H3
SMILES:CCNCCOc1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.