CAS 915923-38-5
:N-Methyl-2-(2,3,5-trimethylphenoxy)ethanamine
Description:
N-Methyl-2-(2,3,5-trimethylphenoxy)ethanamine, identified by its CAS number 915923-38-5, is an organic compound characterized by its amine functional group and a phenoxy moiety. This substance features a methyl group attached to the nitrogen atom, which contributes to its basicity and potential reactivity. The presence of the 2,3,5-trimethylphenoxy group indicates a bulky aromatic structure, which can influence the compound's solubility, stability, and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to the aromatic ring, which can affect their pharmacokinetics if used in medicinal chemistry. Additionally, the amine group can participate in hydrogen bonding, impacting the compound's behavior in various chemical environments. Overall, N-Methyl-2-(2,3,5-trimethylphenoxy)ethanamine is of interest in research contexts, particularly in fields related to organic synthesis and medicinal chemistry, where its unique structural features may confer specific biological activities or applications.
Formula:C12H19NO
InChI:InChI=1/C12H19NO/c1-9-7-10(2)11(3)12(8-9)14-6-5-13-4/h7-8,13H,5-6H2,1-4H3
InChI key:InChIKey=JPDYNOMOWBLNPY-UHFFFAOYSA-N
SMILES:O(CCNC)C1=C(C)C(C)=CC(C)=C1
Synonyms:- N-Methyl-2-(2,3,5-trimethylphenoxy)ethanamine
- Ethanamine, N-methyl-2-(2,3,5-trimethylphenoxy)-
- N-methyl-2-(2,3,5-trimethylphenoxy)ethanamine(SALTDATA: FREE)
- N-methyl-2-(2,3,5-trimethylphenoxy)ethan-1-amine
- UKRORGSYN-BB BBV-253906
- CHEMBRDG-BB 9071444
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.