CAS 915923-39-6

[5-(2,5-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine

Description:

[5-(2,5-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine, with the CAS number 915923-39-6, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This specific compound features a hydrazine functional group, which is known for its reactivity and ability to form various derivatives. The presence of the 2,5-dimethylphenyl substituent contributes to its unique properties, potentially influencing its solubility, stability, and reactivity. Compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research and development. The triazine core can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which may be relevant for synthetic applications. Additionally, the hydrazine moiety can engage in redox reactions, further expanding its utility in organic synthesis. Overall, this compound's structural features suggest potential applications in medicinal chemistry and agrochemicals, although specific biological or chemical activities would require further investigation.

Formula: C₁₁H₁₃N₅

InChI: InChI=1/C11H13N5/c1-7-3-4-8(2)9(5-7)10-6-13-16-11(14-10)15-12/h3-6H,12H2,1-2H3,(H,14,15,16)

SMILES: Cc1ccc(C)c(c1)c1cnnc(n1)NN

5-(2,5-Dimethylphenyl)-3-hydrazino-1,2,4-triazine

CAS: 915923-39-6

Formula: C₁₁H₁₃N₅

Purity: 95.0%

Molecular weight: 215.26

Ref: 10-F061226