CAS 915923-41-0
:6-Oxo-1-(2-propen-1-yl)-3-piperidinecarboxylic acid
Description:
6-Oxo-1-(2-propen-1-yl)-3-piperidinecarboxylic acid, identified by its CAS number 915923-41-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a 2-propen-1-yl substituent that introduces unsaturation and potential reactivity. The presence of the keto group (6-oxo) indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The molecular structure suggests that it may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity will depend on the specific conditions, such as pH and solvent, making it important to consider these factors in practical applications. Overall, this compound's unique structural features position it as a subject of interest in organic synthesis and medicinal chemistry.
Formula:C9H13NO3
InChI:InChI=1S/C9H13NO3/c1-2-5-10-6-7(9(12)13)3-4-8(10)11/h2,7H,1,3-6H2,(H,12,13)
InChI key:InChIKey=AOFDOEKCFHBUKP-UHFFFAOYSA-N
SMILES:C(C=C)N1CC(C(O)=O)CCC1=O
Synonyms:- 3-Piperidinecarboxylic acid, 6-oxo-1-(2-propen-1-yl)-
- 6-Oxo-1-(2-propen-1-yl)-3-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.