CAS 915923-48-7

N-ethyl-2-(p-tolylsulfanyl)ethanamine

Description:

N-ethyl-2-(p-tolylsulfanyl)ethanamine, identified by its CAS number 915923-48-7, is an organic compound characterized by its amine functional group and a thioether moiety. This substance features an ethyl group attached to a nitrogen atom, which is further connected to a two-carbon chain that terminates in a p-tolylsulfanyl group. The presence of the p-tolylsulfanyl group, derived from p-tolyl (a methyl-substituted phenyl group), imparts unique properties, including potential hydrophobic characteristics and the ability to participate in various chemical reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest it could interact with biological systems, possibly influencing neurotransmitter pathways or other physiological processes. As with many amines, it may also be basic in nature, allowing it to form salts with acids. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₇NS

InChI: InChI=1/C11H17NS/c1-3-12-8-9-13-11-6-4-10(2)5-7-11/h4-7,12H,3,8-9H2,1-2H3

SMILES: CCNCCSc1ccc(C)cc1

N-ethyl-2-[(4-methylphenyl)thio]ethanamine

CAS: 915923-48-7

Formula: C₁₁H₁₇NS

Purity: 95.0%

Molecular weight: 195.32

Ref: 10-F316222