CymitQuimica logo

CAS 915923-51-2

:

3-Chloro-N-(3,5-dimethoxyphenyl)propanamide

Description:
3-Chloro-N-(3,5-dimethoxyphenyl)propanamide is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third position of the propanamide chain contributes to its reactivity and potential biological activity. The compound features a 3,5-dimethoxyphenyl group, which indicates the presence of two methoxy (-OCH3) substituents on a phenyl ring, enhancing its lipophilicity and possibly influencing its interaction with biological targets. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, such as solubility, melting point, and stability, would be influenced by the balance of polar and nonpolar characteristics imparted by the functional groups. Additionally, the chlorine substituent may affect the compound's electronic properties and reactivity, making it a subject of interest in synthetic and medicinal chemistry research. Overall, 3-Chloro-N-(3,5-dimethoxyphenyl)propanamide exemplifies a complex organic molecule with potential applications in various chemical fields.
Formula:C11H14ClNO3
InChI:InChI=1S/C11H14ClNO3/c1-15-9-5-8(6-10(7-9)16-2)13-11(14)3-4-12/h5-7H,3-4H2,1-2H3,(H,13,14)
InChI key:InChIKey=FWJIKACTNJJWAJ-UHFFFAOYSA-N
SMILES:N(C(CCCl)=O)C1=CC(OC)=CC(OC)=C1
Synonyms:
  • 3-Chloro-N-(3,5-dimethoxyphenyl)propanamide
  • Propanamide, 3-chloro-N-(3,5-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.