CAS 915923-52-3

3-[(Acetyloxy)methyl]-4-ethoxybenzaldehyde

Description:

3-[(Acetyloxy)methyl]-4-ethoxybenzaldehyde is an organic compound characterized by its functional groups and structural features. It contains a benzaldehyde moiety, which is a key feature of aromatic aldehydes, contributing to its reactivity and potential applications in organic synthesis. The presence of an ethoxy group enhances its solubility in organic solvents and may influence its electronic properties. The acetyloxy group introduces an ester functionality, which can participate in various chemical reactions, such as esterification or hydrolysis. This compound may exhibit interesting biological activities due to its structural components, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in the synthesis of more complex organic molecules or as an intermediate in the production of pharmaceuticals. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the benzene ring. Overall, 3-[(Acetyloxy)methyl]-4-ethoxybenzaldehyde is a versatile compound with potential utility in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₄O₄

InChI: InChI=1S/C12H14O4/c1-3-15-12-5-4-10(7-13)6-11(12)8-16-9(2)14/h4-7H,3,8H2,1-2H3

InChI key: InChIKey=VFSCOQZLSGLLFQ-UHFFFAOYSA-N

SMILES: C(OC(C)=O)C1=C(OCC)C=CC(C=O)=C1

Synonyms:

• 3-[(Acetyloxy)methyl]-4-ethoxybenzaldehyde
• Benzaldehyde, 3-[(acetyloxy)methyl]-4-ethoxy-

2-ethoxy-5-formylbenzyl acetate

CAS: 915923-52-3

Formula: C₁₂H₁₄O₄

Purity: 95.0%

Molecular weight: 222.24

Ref: 10-F316239