CymitQuimica logo

CAS 915923-55-6

:

N-(2-Formyl-6-quinolinyl)acetamide

Description:
N-(2-Formyl-6-quinolinyl)acetamide is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features an acetamide functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the formyl group (–CHO) indicates that it can participate in condensation reactions, making it useful in synthetic organic chemistry. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amide group, while its aromatic nature may provide some degree of hydrophobicity. Additionally, the quinoline moiety is known for its biological activity, which may suggest potential pharmacological properties. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or irritant properties. Overall, N-(2-Formyl-6-quinolinyl)acetamide represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c1-8(16)13-10-4-5-12-9(6-10)2-3-11(7-15)14-12/h2-7H,1H3,(H,13,16)
InChI key:InChIKey=GKQGSRDYZYMTCE-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC2=C(N=C(C=O)C=C2)C=C1
Synonyms:
  • Acetamide, N-(2-formyl-6-quinolinyl)-
  • N-(2-Formyl-6-quinolinyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.