CAS 915923-59-0

2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine

Description:

2-(4-chlorophenyl)-2-pyrrolidin-1-ylethanamine, also known as a substituted phenethylamine, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a chlorophenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the 4-chlorophenyl group may influence its lipophilicity and biological activity, potentially affecting its interaction with various receptors in the central nervous system. As a result, compounds of this class are often studied for their pharmacological effects, including potential stimulant or psychoactive properties. The compound's molecular structure suggests it may participate in various chemical reactions, including alkylation and acylation, and it may also serve as a precursor in the synthesis of more complex molecules. Safety and handling precautions are essential when working with this substance, as with many organic compounds, due to potential toxicity and environmental impact.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1/C12H17ClN2/c13-11-5-3-10(4-6-11)12(9-14)15-7-1-2-8-15/h3-6,12H,1-2,7-9,14H2

SMILES: C1CCN(C1)C(CN)c1ccc(cc1)Cl

Synonyms:

• 1-Pyrrolidineethanamine, Β-(4-Chlorophenyl)-

2-(4-Chloro-phenyl)-2-pyrrolidin-1-yl-ethylamine

CAS: 915923-59-0

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 224.73 g/mol

Ref: 3D-QLB92359