CAS 915923-60-3

4-Methyl-3-[(3-methyl-1-oxobutyl)amino]benzoic acid

Description:

4-Methyl-3-[(3-methyl-1-oxobutyl)amino]benzoic acid, with the CAS number 915923-60-3, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and an amino group. The presence of the amino group indicates potential basic properties, while the carboxylic acid group contributes to its acidity. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of both hydrophobic (methyl and aromatic) and hydrophilic (carboxylic acid and amino) functional groups. Its molecular structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit specific biological activities, which would be of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1S/C13H17NO3/c1-8(2)6-12(15)14-11-7-10(13(16)17)5-4-9(11)3/h4-5,7-8H,6H2,1-3H3,(H,14,15)(H,16,17)

InChI key: InChIKey=ZZUQMZLGKVBIQM-UHFFFAOYSA-N

SMILES: N(C(CC(C)C)=O)C1=CC(C(O)=O)=CC=C1C

Synonyms:

• 4-Methyl-3-[(3-methyl-1-oxobutyl)amino]benzoic acid
• Benzoic Acid, 4-Methyl-3-[(3-Methyl-1-Oxobutyl)Amino]-

4-Methyl-3-[(3-methylbutanoyl)amino]benzoic acid

CAS: 915923-60-3

Formula: C₁₃H₁₇NO₃

Purity: 95.0%

Molecular weight: 235.283

Ref: 10-F075105