CAS 915923-65-8

2-[(5-formylpyrimidin-2-yl)amino]acetic acid

Description:

2-[(5-formylpyrimidin-2-yl)amino]acetic acid, with the CAS number 915923-65-8, is a chemical compound that features a pyrimidine ring substituted with a formyl group and an aminoacetic acid moiety. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a building block for drug development or as a ligand in biochemical assays. The presence of the formyl group suggests reactivity that could facilitate further chemical modifications, while the aminoacetic acid component contributes to its solubility and potential interactions with biological targets. The compound's structure indicates it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. Additionally, its unique combination of functional groups may impart specific pharmacological properties, making it of interest in research related to pharmaceuticals or agrochemicals. Overall, 2-[(5-formylpyrimidin-2-yl)amino]acetic acid represents a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₇H₇N₃O₃

InChI: InChI=1/C7H7N3O3/c11-4-5-1-8-7(9-2-5)10-3-6(12)13/h1-2,4H,3H2,(H,12,13)(H,8,9,10)

SMILES: c1c(cnc(n1)NCC(=O)O)C=O

Synonyms:

• glycine, N-(5-formyl-2-pyrimidinyl)-
• N-(5-formylpyrimidin-2-yl)glycine

N-(5-formylpyrimidin-2-yl)glycine

CAS: 915923-65-8

Formula: C₇H₇N₃O₃

Purity: 95.0%

Molecular weight: 181.151

Ref: 10-F310063

N-(5-Formylpyrimidin-2-yl)glycine

Controlled Product

CAS: 915923-65-8

Applications N-(5-formylpyrimidin-2-yl)glycine (cas# 915923-65-8) is a useful research chemical.

Formula: C₇H₇N₃O₃

Color and Shape: Neat

Molecular weight: 181.14

Ref: TR-F594288

N-(5-Formylpyrimidin-2-yl)glycine

CAS: 915923-65-8

Versatile small molecule scaffold

Formula: C₇H₇N₃O₃

Purity: Min. 95%

Molecular weight: 181.15 g/mol

Ref: 3D-QLB92365