CAS 915923-75-0

6,7-Dimethyl-1H-benzimidazole-2-ethanamine

Description:

6,7-Dimethyl-1H-benzimidazole-2-ethanamine is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features two methyl groups at the 6 and 7 positions of the benzimidazole ring, contributing to its unique chemical properties and potential biological activity. The presence of an ethanamine side chain at the 2-position enhances its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the methyl groups and the amine functional group, which may participate in hydrogen bonding and other intermolecular interactions. Overall, 6,7-Dimethyl-1H-benzimidazole-2-ethanamine represents a class of compounds that may have significant implications in research and therapeutic applications.

Formula: C₁₁H₁₅N₃

InChI: InChI=1S/C11H15N3/c1-7-3-4-9-11(8(7)2)14-10(13-9)5-6-12/h3-4H,5-6,12H2,1-2H3,(H,13,14)

InChI key: InChIKey=HEZISPUWFNYMKU-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(CCN)N2)=CC=C1C

Synonyms:

• 2-(6,7-Dimethyl-1H-1,3-benzodiazol-2-yl)ethan-1-amine
• 6,7-Dimethyl-1H-benzimidazole-2-ethanamine
• 1H-Benzimidazole-2-ethanamine, 6,7-dimethyl-
• 2-(4,5-Dimethyl-1H-1,3-benzodiazol-2-yl)ethan-1-amine