CAS 915923-77-2

7-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole

Description:

7-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole, identified by its CAS number 915923-77-2, is a chemical compound that belongs to the class of benzimidazoles, which are characterized by a fused benzene and imidazole ring structure. This compound features a methyl group at the 7-position and a pyrrolidine substituent at the 2-position, contributing to its unique chemical properties. Benzimidazoles are known for their diverse biological activities, including potential applications in pharmaceuticals, such as anti-parasitic and anti-cancer agents. The presence of the pyrrolidine ring may enhance its solubility and bioavailability, making it a subject of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and solvent. Further research would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₂H₁₅N₃

InChI: InChI=1S/C12H15N3/c1-8-4-2-5-9-11(8)15-12(14-9)10-6-3-7-13-10/h2,4-5,10,13H,3,6-7H2,1H3,(H,14,15)

InChI key: InChIKey=KUFMTQOQTXECOQ-UHFFFAOYSA-N

SMILES: CC1=C2NC(=NC2=CC=C1)C3CCCN3

Synonyms:

• 7-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole
• 1H-Benzimidazole, 7-methyl-2-(2-pyrrolidinyl)-