CAS 915923-84-1

4-[2-(4-methylpiperidin-1-yl)-2-oxoethoxy]benzaldehyde

Description:

4-[2-(4-Methylpiperidin-1-yl)-2-oxoethoxy]benzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety and a piperidine derivative. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, such as condensation and nucleophilic addition. The 4-methylpiperidine ring enhances its solubility in organic solvents and may influence its biological activity, potentially acting as a pharmacophore in medicinal chemistry. The compound's oxoethoxy group introduces additional polar characteristics, which can affect its interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in drug development and synthesis, particularly in the design of compounds with specific pharmacological properties. Its molecular weight, melting point, and solubility characteristics would need to be determined experimentally for practical applications.

Formula: C₁₅H₁₉NO₃

InChI: InChI=1/C15H19NO3/c1-12-6-8-16(9-7-12)15(18)11-19-14-4-2-13(10-17)3-5-14/h2-5,10,12H,6-9,11H2,1H3

SMILES: CC1CCN(CC1)C(=O)COc1ccc(cc1)C=O

Synonyms:

• Benzaldehyde, 4-[2-(4-methyl-1-piperidinyl)-2-oxoethoxy]-
• 4-[2-(4-Methylpiperidin-1-yl)-2-oxoethoxy]benzaldehyde

4-[2-(4-Methyl-1-piperidinyl)-2-oxoethoxy]benzaldehyde

CAS: 915923-84-1

Formula: C₁₅H₁₉NO₃

Purity: 95.0%

Molecular weight: 261.321

Ref: 10-F039368