CAS 915923-86-3
:5-(2-Phenoxyethyl)-1,3,4-thiadiazol-2-amine
Description:
5-(2-Phenoxyethyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a phenoxyethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiadiazole moiety, which is known for its role in various pharmacological applications. The phenoxyethyl substituent may enhance lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound's amine functional group can participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Additionally, the presence of sulfur in the thiadiazole ring can impart distinct electronic properties, making it of interest in medicinal chemistry and material science. Overall, 5-(2-Phenoxyethyl)-1,3,4-thiadiazol-2-amine is a compound that may exhibit diverse chemical behavior and potential applications, warranting further investigation into its properties and uses.
Formula:C10H11N3OS
InChI:InChI=1S/C10H11N3OS/c11-10-13-12-9(15-10)6-7-14-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,13)
InChI key:InChIKey=YZEIHPOKYUQDBF-UHFFFAOYSA-N
SMILES:C(COC1=CC=CC=C1)C=2SC(N)=NN2
Synonyms:- 5-(2-Phenoxyethyl)-1,3,4-thiadiazol-2-amine
- 1,3,4-Thiadiazol-2-amine, 5-(2-phenoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
