CymitQuimica logo

CAS 915923-88-5

:

1-(Methoxymethyl)-1H-1,2,4-triazol-3-amine

Description:
1-(Methoxymethyl)-1H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methoxymethyl group, which contributes to its solubility and reactivity. The presence of an amine functional group indicates potential for hydrogen bonding and reactivity in various chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. The molecular structure allows for various interactions with biological targets, and its properties can be influenced by the substituents on the triazole ring. Additionally, the compound's stability, solubility, and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 1-(Methoxymethyl)-1H-1,2,4-triazol-3-amine represents a class of compounds that may have significant applications in medicinal chemistry and agrochemicals.
Formula:C4H8N4O
InChI:InChI=1S/C4H8N4O/c1-9-3-8-2-6-4(5)7-8/h2H,3H2,1H3,(H2,5,7)
InChI key:InChIKey=DEVALVYCKJZHRY-UHFFFAOYSA-N
SMILES:C(OC)N1N=C(N)N=C1
Synonyms:
  • 1-(Methoxymethyl)-1H-1,2,4-triazol-3-amine
  • 1H-1,2,4-Triazol-3-amine, 1-(methoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.