CAS 915923-89-6
:4-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde
Description:
4-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde, with the CAS number 915923-89-6, is an organic compound characterized by its aromatic aldehyde structure. It features a benzaldehyde moiety, which is a common functional group known for its reactivity and presence in various organic synthesis processes. The compound contains a propoxy group linked to the benzaldehyde, which enhances its solubility and reactivity. Additionally, the presence of a 3-methyl-1-piperidinyl group contributes to its potential biological activity, as piperidine derivatives are often associated with pharmacological properties. This compound may exhibit moderate to high lipophilicity due to its hydrophobic aromatic and aliphatic components, influencing its behavior in biological systems. Its synthesis and applications could be relevant in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C16H23NO2
InChI:InChI=1S/C16H23NO2/c1-14-4-2-9-17(12-14)10-3-11-19-16-7-5-15(13-18)6-8-16/h5-8,13-14H,2-4,9-12H2,1H3
InChI key:InChIKey=HMFBUSMMRGDVNG-UHFFFAOYSA-N
SMILES:O(CCCN1CC(C)CCC1)C2=CC=C(C=O)C=C2
Synonyms:- Benzaldehyde, 4-[3-(3-methyl-1-piperidinyl)propoxy]-
- 4-[3-(3-Methyl-1-piperidinyl)propoxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.