CAS 915923-90-9

1-(2-fluorophenyl)-2,2-dimethyl-cyclopropanecarboxylic acid

Description:

1-(2-Fluorophenyl)-2,2-dimethyl-cyclopropanecarboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which contributes to its rigidity and potential reactivity. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound features a carboxylic acid functional group, which is known for its acidity and ability to participate in hydrogen bonding, affecting its solubility and reactivity in various environments. The dimethyl substitution on the cyclopropane ring introduces steric hindrance, which can impact the compound's conformational dynamics and interactions with biological targets. Overall, the combination of these structural features suggests that 1-(2-fluorophenyl)-2,2-dimethyl-cyclopropanecarboxylic acid may exhibit interesting pharmacological properties, warranting further investigation in drug development and chemical synthesis applications.

Formula: C₁₂H₁₃FO₂

InChI: InChI=1/C12H13FO2/c1-11(2)7-12(11,10(14)15)8-5-3-4-6-9(8)13/h3-6H,7H2,1-2H3,(H,14,15)

SMILES: CC1(C)CC1(c1ccccc1F)C(=O)O

1-(2-fluorophenyl)-2,2-dimethylcyclopropanecarboxylic acid

CAS: 915923-90-9

Formula: C₁₂H₁₃FO₂

Purity: 95.0%

Molecular weight: 208.232

Ref: 10-F308691