CymitQuimica logo

CAS 915923-93-2

:

2-(4-Bromophenoxy)-N-ethylethanamine

Description:
2-(4-Bromophenoxy)-N-ethylethanamine, with the CAS number 915923-93-2, is a chemical compound characterized by its unique structure, which includes a bromophenyl group and an ethylamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine atom in the para position of the phenoxy group can impart specific electronic effects, potentially enhancing its reactivity and interaction with biological targets. The ethyl group attached to the nitrogen atom contributes to its steric properties, which may affect its pharmacological profile if used in medicinal chemistry. Additionally, the compound may exhibit moderate lipophilicity due to the aromatic and aliphatic components, influencing its bioavailability and distribution in biological systems. Overall, 2-(4-Bromophenoxy)-N-ethylethanamine is of interest in research contexts, particularly in studies related to pharmacology and organic synthesis.
Formula:C10H14BrNO
InChI:InChI=1S/C10H14BrNO/c1-2-12-7-8-13-10-5-3-9(11)4-6-10/h3-6,12H,2,7-8H2,1H3
InChI key:InChIKey=VAOKMHDRGYZBED-UHFFFAOYSA-N
SMILES:O(CCNCC)C1=CC=C(Br)C=C1
Synonyms:
  • Ethanamine, 2-(4-bromophenoxy)-N-ethyl-
  • 2-(4-Bromophenoxy)-N-ethylethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.