CAS 915923-94-3

1-(2-Methoxyethyl)-N-methyl-3-piperidinemethanamine

Description:

1-(2-Methoxyethyl)-N-methyl-3-piperidinemethanamine, with the CAS number 915923-94-3, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a methoxyethyl group and a methyl group on the nitrogen atom. This compound is typically classified as an amine due to the presence of the amine functional group. It is likely to exhibit properties such as moderate solubility in polar solvents due to the methoxy group, which can enhance its interaction with water. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the compound may exhibit basicity due to the nitrogen atom, allowing it to participate in acid-base reactions. Its specific applications and reactivity would depend on further studies, including its interaction with biological systems or other chemical entities. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.

Formula: C₁₀H₂₂N₂O

InChI: InChI=1S/C10H22N2O/c1-11-8-10-4-3-5-12(9-10)6-7-13-2/h10-11H,3-9H2,1-2H3

InChI key: InChIKey=PJCPPFOHZHGUJK-UHFFFAOYSA-N

SMILES: C(COC)N1CC(CNC)CCC1

Synonyms:

• 3-Piperidinemethanamine, 1-(2-methoxyethyl)-N-methyl-
• 1-(2-Methoxyethyl)-N-methyl-3-piperidinemethanamine

1-[1-(2-methoxyethyl)piperidin-3-yl]-N-methylmethanamine

CAS: 915923-94-3

Formula: C₁₀H₂₂N₂O

Purity: 95.0%

Molecular weight: 186.299

Ref: 10-F308735