CAS 915923-95-4
:3-Chloro-N-(2,5-difluorophenyl)propanamide
Description:
3-Chloro-N-(2,5-difluorophenyl)propanamide is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical or agrochemical intermediate. The presence of a chloro substituent and difluorophenyl group suggests that it may exhibit unique electronic properties and reactivity, making it of interest in medicinal chemistry. The compound's structure includes a propanamide backbone, which contributes to its solubility and interaction with biological targets. Its molecular weight and specific physical properties, such as melting point and boiling point, would depend on the arrangement of atoms and the presence of functional groups. Additionally, the compound's reactivity may be influenced by the electronegative fluorine and chlorine atoms, which can affect hydrogen bonding and overall stability. Safety and handling considerations would be essential due to the presence of halogenated groups, which may pose environmental and health risks. Overall, 3-Chloro-N-(2,5-difluorophenyl)propanamide represents a compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H8ClF2NO
InChI:InChI=1S/C9H8ClF2NO/c10-4-3-9(14)13-8-5-6(11)1-2-7(8)12/h1-2,5H,3-4H2,(H,13,14)
InChI key:InChIKey=LZGXREHKHPGFJK-UHFFFAOYSA-N
SMILES:N(C(CCCl)=O)C1=C(F)C=CC(F)=C1
Synonyms:- propanamide, 3-chloro-N-(2,5-difluorophenyl)-
- 3-Chloro-N-(2,5-difluorophenyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
