CymitQuimica logo

CAS 915923-97-6

:

3-[(2-ethylbutanoyl)amino]benzoic acid

Description:
3-[(2-Ethylbutanoyl)amino]benzoic acid, identified by its CAS number 915923-97-6, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group, which classifies it as an amino acid derivative. The structure features a benzoic acid moiety, where a 2-ethylbutanoyl group is attached to the amino position at the meta position relative to the carboxylic acid. This compound is likely to exhibit properties typical of amino acids, such as solubility in polar solvents and the ability to participate in hydrogen bonding due to its functional groups. Additionally, the presence of the bulky 2-ethylbutanoyl group may influence its steric properties and reactivity. The compound may also have potential applications in pharmaceuticals or biochemistry, particularly in the synthesis of peptides or as a building block in drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H17NO3
InChI:InChI=1/C13H17NO3/c1-3-9(4-2)12(15)14-11-7-5-6-10(8-11)13(16)17/h5-9H,3-4H2,1-2H3,(H,14,15)(H,16,17)
SMILES:CCC(CC)C(=Nc1cccc(c1)C(=O)O)O
Synonyms:
  • 3-(2-Ethylbutanamido)Benzoic Acid
  • Benzoic Acid, 3-[(2-Ethyl-1-Oxobutyl)Amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.