CAS 915924-02-6
:2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]acetic acid
Description:
2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety and a methoxyacetic acid functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The benzimidazole ring contributes to its potential biological activity, as compounds containing this structure are often associated with various pharmacological effects. The presence of the methyl group on the benzimidazole enhances its lipophilicity, potentially influencing its interaction with biological membranes. Additionally, the methoxy group can affect the compound's reactivity and stability. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities would require further investigation through experimental studies.
Formula:C11H12N2O3
InChI:InChI=1/C11H12N2O3/c1-7-3-2-4-8-11(7)13-9(12-8)5-16-6-10(14)15/h2-4H,5-6H2,1H3,(H,12,13)(H,14,15)
SMILES:Cc1cccc2c1[nH]c(COCC(=O)O)n2
Synonyms:- [(4-methyl-1H-benzimidazol-2-yl)methoxy]acetic acid
- acetic acid, 2-[(4-methyl-1H-benzimidazol-2-yl)methoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.