CymitQuimica logo

CAS 915924-05-9

:

3-chloro-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)propanamide

Description:
3-Chloro-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)propanamide is a chemical compound characterized by its unique structure, which includes a chlorinated moiety and a thiadiazole ring. The presence of the cyclopropyl group contributes to its three-dimensional shape, potentially influencing its biological activity and interactions. This compound features a propanamide functional group, which is known for its ability to participate in hydrogen bonding, enhancing its solubility in polar solvents. The thiadiazole ring is notable for its role in various pharmacological activities, often associated with antimicrobial and anti-inflammatory properties. The chlorine atom introduces additional reactivity and can affect the compound's lipophilicity, influencing its absorption and distribution in biological systems. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C8H10ClN3OS
InChI:InChI=1/C8H10ClN3OS/c9-4-3-6(13)10-8-12-11-7(14-8)5-1-2-5/h5H,1-4H2,(H,10,12,13)
SMILES:C1CC1c1nnc(N=C(CCCl)O)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.