CAS 915924-07-1

2-amino-6-isobutyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

Description:

2-amino-6-isobutyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyrimidine moiety. This compound features an amino group at the 2-position, an isobutyl group at the 6-position, and a methyl group at the 5-position of the triazole ring. The presence of the hydroxyl group at the 7-position contributes to its potential as a bioactive molecule. The unique arrangement of these functional groups may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by its structural features, which may also affect its interactions with biological targets. As a result, it may exhibit various biological activities, although specific applications would depend on further research and characterization. Overall, this compound represents a class of triazolopyrimidine derivatives that could have implications in drug development and therapeutic applications.

Formula: C₁₀H₁₅N₅O

InChI: InChI=1/C10H15N5O/c1-5(2)4-7-6(3)12-10-13-9(11)14-15(10)8(7)16/h5,16H,4H2,1-3H3,(H2,11,14)

SMILES: CC(C)Cc1c(C)nc2nc(=N)[nH]n2c1O

2-amino-6-isobutyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

CAS: 915924-07-1

Formula: C₁₀H₁₅N₅O

Purity: 95.0%

Molecular weight: 221.264

Ref: 10-F316006