CAS 915924-18-4
:2,2-Dimethyl-1-(2-thienyl)cyclopropanemethanol
Description:
2,2-Dimethyl-1-(2-thienyl)cyclopropanemethanol is an organic compound characterized by its unique cyclopropane structure, which is a three-membered carbon ring. The presence of two methyl groups at the 2-position of the cyclopropane enhances its steric properties, while the thienyl group, derived from thiophene, introduces aromatic characteristics and potential reactivity due to the presence of sulfur. This compound features a hydroxyl (-OH) group, which contributes to its polarity and solubility in polar solvents. The thienyl moiety can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and potentially in medicinal chemistry for its biological activity. Its structural features suggest that it may exhibit interesting physical properties, such as melting and boiling points, which are influenced by the steric hindrance and the presence of the aromatic ring. Overall, 2,2-Dimethyl-1-(2-thienyl)cyclopropanemethanol is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H14OS
InChI:InChI=1S/C10H14OS/c1-9(2)6-10(9,7-11)8-4-3-5-12-8/h3-5,11H,6-7H2,1-2H3
InChI key:InChIKey=RVTAADFYFHVQGI-UHFFFAOYSA-N
SMILES:C(O)C1(C(C)(C)C1)C2=CC=CS2
Synonyms:- Cyclopropanemethanol, 2,2-dimethyl-1-(2-thienyl)-
- 2,2-Dimethyl-1-(2-thienyl)cyclopropanemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.