CAS 915924-25-3

5-[2-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine

Description:

5-[2-(4-Ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and an ethylphenoxy side chain. The thiadiazole moiety contributes to its potential biological activity, as compounds containing this functional group are often investigated for their pharmacological properties. The presence of the ethylphenoxy group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 915924-25-3, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of thiadiazole derivatives that may hold promise for further research in drug development and other applications in chemistry and biochemistry.

Formula: C₁₂H₁₅N₃OS

InChI: InChI=1/C12H15N3OS/c1-2-9-3-5-10(6-4-9)16-8-7-11-14-15-12(13)17-11/h3-6H,2,7-8H2,1H3,(H2,13,15)

SMILES: CCc1ccc(cc1)OCCc1n[nH]c(=N)s1

5-[2-(4-Ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine

CAS: 915924-25-3

Formula: C₁₂H₁₅N₃OS

Purity: 95.0%

Molecular weight: 249.33

Ref: 10-F075372