CAS 915924-30-0

(E)-3-(2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid

Description:

(E)-3-(2-methylsulfanylpyrimidin-5-yl)prop-2-enoic acid, with the CAS number 915924-30-0, is an organic compound characterized by its unique structure that includes a prop-2-enoic acid moiety and a pyrimidine ring substituted with a methylsulfanyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, which can influence its reactivity and solubility. The presence of the pyrimidine ring suggests potential biological activity, as pyrimidines are often found in nucleic acids and various pharmaceuticals. The methylsulfanyl group may enhance lipophilicity and affect the compound's interaction with biological targets. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific molecular interactions. The compound's potential applications could span medicinal chemistry, particularly in the development of new therapeutic agents, given the significance of pyrimidine derivatives in drug design. Overall, its unique structural features contribute to its chemical behavior and potential utility in various fields.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-13-8-9-4-6(5-10-8)2-3-7(11)12/h2-5H,1H3,(H,11,12)/b3-2+

Synonyms:

• (2E)-3-[2-(Methylsulfanyl)pyrimidin-5-yl]acrylic acid
• 2-propenoic acid, 3-[2-(methylthio)-5-pyrimidinyl]-, (2E)-

(2E)-3-[2-(methylthio)pyrimidin-5-yl]acrylic acid

CAS: 915924-30-0

Formula: C₈H₈N₂O₂S

Purity: 95.0%

Molecular weight: 196.22

Ref: 10-F309063