CymitQuimica logo

CAS 915924-36-6

:

[3-(aminomethyl)-1-piperidyl]-cyclopropyl-methanone

Description:
[3-(Aminomethyl)-1-piperidyl]-cyclopropyl-methanone, with the CAS number 915924-36-6, is a chemical compound characterized by its unique structural features, including a piperidine ring and a cyclopropyl group. The presence of the aminomethyl group suggests that it has potential for forming hydrogen bonds, which can influence its solubility and reactivity. This compound may exhibit biological activity due to its structural similarity to various pharmacologically active substances, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the cyclopropyl moiety can impart unique steric and electronic properties, affecting the compound's overall stability and reactivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c11-6-8-2-1-5-12(7-8)10(13)9-3-4-9/h8-9H,1-7,11H2
SMILES:C1CC(CN)CN(C1)C(=O)C1CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.