CAS 915924-40-2
:N,5-Diethyl-1,3,4-oxadiazole-2-methanamine
Description:
N,5-Diethyl-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the diethyl groups enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The methanamine functional group may impart basic properties, allowing for interactions with various biological targets. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its specific reactivity and stability can be influenced by environmental factors such as pH and temperature. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, making it a candidate for further research in therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C7H13N3O
InChI:InChI=1S/C7H13N3O/c1-3-6-9-10-7(11-6)5-8-4-2/h8H,3-5H2,1-2H3
InChI key:InChIKey=QLNBHJBPDCQEQQ-UHFFFAOYSA-N
SMILES:C(NCC)C=1OC(CC)=NN1
Synonyms:- N,5-Diethyl-1,3,4-oxadiazole-2-methanamine
- 1,3,4-Oxadiazole-2-methanamine, N,5-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.