CAS 915924-43-5

N-methyl-2-(4-methyl-1-piperidyl)ethanamine

Description:

N-methyl-2-(4-methyl-1-piperidyl)ethanamine, also known by its CAS number 915924-43-5, is a chemical compound characterized by its amine functional group and piperidine ring structure. This substance features a methyl group attached to the nitrogen atom of the piperidine, which contributes to its basicity and potential for forming hydrogen bonds. The presence of the ethyl chain links the piperidine moiety to the amine group, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit psychoactive properties, as they can interact with neurotransmitter systems in the brain. The molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological conditions. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, making it a versatile compound in synthetic organic chemistry.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-9-3-6-11(7-4-9)8-5-10-2/h9-10H,3-8H2,1-2H3

SMILES: CC1CCN(CC1)CCNC

N-methyl-2-(4-methylpiperidin-1-yl)ethanamine

CAS: 915924-43-5

Formula: C₉H₂₀N₂

Purity: 95.0%

Molecular weight: 156.273

Ref: 10-F309254