CymitQuimica logo

CAS 915924-49-1

:

2-[[2-(1-Pyrrolidinyl)ethyl]thio]acetic acid

Description:
2-[[2-(1-Pyrrolidinyl)ethyl]thio]acetic acid, identified by its CAS number 915924-49-1, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a thioether functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group. It is likely to be soluble in polar solvents, given the presence of the hydrophilic carboxylic acid, while the pyrrolidine moiety may contribute to its lipophilicity. The thioether linkage can influence its reactivity and stability, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds with similar structures may exhibit biological activity, making them of interest in medicinal chemistry. Overall, 2-[[2-(1-Pyrrolidinyl)ethyl]thio]acetic acid represents a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H15NO2S
InChI:InChI=1S/C8H15NO2S/c10-8(11)7-12-6-5-9-3-1-2-4-9/h1-7H2,(H,10,11)
InChI key:InChIKey=UQDJUXAXQOVVLW-UHFFFAOYSA-N
SMILES:C(CSCC(O)=O)N1CCCC1
Synonyms:
  • 2-[[2-(Pyrrolidin-1-yl)ethyl]sulfanyl]acetic acid
  • 2-[[2-(1-Pyrrolidinyl)ethyl]thio]acetic acid
  • 2-(2-Pyrrolidin-1-ium-1-ylethylsulfanyl)acetate
  • Acetic acid, 2-[[2-(1-pyrrolidinyl)ethyl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.