CAS 915924-55-9
:(2-aminophenyl)-(benzimidazol-1-yl)methanone
Description:
(2-aminophenyl)-(benzimidazol-1-yl)methanone, identified by its CAS number 915924-55-9, is a chemical compound that features a benzimidazole moiety linked to an aminophenyl group through a methanone functional group. This compound typically exhibits characteristics common to both aromatic amines and heterocyclic compounds, including potential biological activity due to its structural components. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The benzimidazole ring contributes to its stability and may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence or other optical properties due to its conjugated structure. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for applications in pharmaceuticals, particularly in the development of therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with amine functionalities.
Formula:C14H11N3O
InChI:InChI=1/C14H11N3O/c15-11-6-2-1-5-10(11)14(18)17-9-16-12-7-3-4-8-13(12)17/h1-9H,15H2
SMILES:c1ccc(c(c1)C(=O)n1cnc2ccccc12)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.