CAS 915924-63-9

N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propan-2-amine

Description:

N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propan-2-amine is a chemical compound characterized by its unique structure, which includes a propan-2-amine backbone and a 5-methyl-1,2,4-oxadiazole moiety. This compound features a nitrogen-containing heterocyclic ring, which contributes to its potential biological activity and chemical reactivity. The presence of the oxadiazole ring suggests that it may exhibit properties such as antimicrobial or anti-inflammatory effects, as many oxadiazole derivatives are known for their pharmacological activities. The propan-2-amine portion indicates that the compound has amine functionality, which can participate in hydrogen bonding and influence solubility in various solvents. Additionally, the methyl group on the oxadiazole ring may enhance lipophilicity, potentially affecting the compound's bioavailability. Overall, this compound's structural characteristics suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation.

Formula: C₇H₁₃N₃O

InChI: InChI=1/C7H13N3O/c1-5(2)8-4-7-9-6(3)11-10-7/h5,8H,4H2,1-3H3

SMILES: CC(C)NCc1nc(C)on1

Synonyms:

• 1,2,4-oxadiazole-3-methanamine, 5-methyl-N-(1-methylethyl)-

N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]propan-2-amine

CAS: 915924-63-9

Formula: C₇H₁₃N₃O

Purity: 95.0%

Molecular weight: 155.201

Ref: 10-F309208