CAS 915924-65-1

N-[2-(4-methyl-1-piperidyl)ethyl]propan-2-amine

Description:

N-[2-(4-methyl-1-piperidyl)ethyl]propan-2-amine, with the CAS number 915924-65-1, is a chemical compound that belongs to the class of amines. It features a piperidine ring substituted with a methyl group, which contributes to its structural complexity and potential biological activity. The compound is characterized by its amine functional group, which typically imparts basic properties and allows for hydrogen bonding. Its molecular structure suggests it may interact with various biological targets, making it of interest in pharmacological research. The presence of the piperidine moiety may influence its lipophilicity and ability to cross biological membranes, which is crucial for drug development. Additionally, the compound's potential applications could extend to areas such as neuroscience or medicinal chemistry, where derivatives of piperidine are often explored for their therapeutic effects. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and its use should be guided by appropriate regulatory standards.

Formula: C₁₁H₂₄N₂

InChI: InChI=1/C11H24N2/c1-10(2)12-6-9-13-7-4-11(3)5-8-13/h10-12H,4-9H2,1-3H3

SMILES: CC(C)NCCN1CCC(C)CC1

N-[2-(4-methylpiperidin-1-yl)ethyl]propan-2-amine

CAS: 915924-65-1

Formula: C₁₁H₂₄N₂

Purity: 95.0%

Molecular weight: 184.327

Ref: 10-F309252