CAS 915924-87-7

[5-(3,4-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine

Description:

[5-(3,4-dimethylphenyl)-1,2,4-triazin-3-yl]hydrazine is a chemical compound characterized by its unique structure, which includes a triazine ring and a hydrazine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the 3,4-dimethylphenyl group enhances its lipophilicity, which may influence its solubility in organic solvents. The triazine moiety is known for its applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to act as a building block for more complex molecules. Additionally, the hydrazine group can participate in various chemical reactions, including oxidation and condensation, making this compound versatile in synthetic chemistry. Its specific applications and biological activity would depend on further studies, including its interaction with biological targets and its overall toxicity profile. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its components.

Formula: C₁₁H₁₃N₅

InChI: InChI=1/C11H13N5/c1-7-3-4-9(5-8(7)2)10-6-13-16-11(14-10)15-12/h3-6H,12H2,1-2H3,(H,14,15,16)

SMILES: Cc1ccc(cc1C)c1cnnc(n1)NN

5-(3,4-Dimethylphenyl)-3-hydrazino-1,2,4-triazine

CAS: 915924-87-7

Formula: C₁₁H₁₃N₅

Purity: 95.0%

Molecular weight: 215.26

Ref: 10-F061225