CAS 915924-89-9

[5-(4-ethylphenyl)-1,2,4-triazin-3-yl]hydrazine

Description:

[5-(4-ethylphenyl)-1,2,4-triazin-3-yl]hydrazine, with the CAS number 915924-89-9, is a chemical compound characterized by its unique structure that includes a triazine ring and a hydrazine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and stability. The presence of the ethylphenyl group enhances its lipophilicity, potentially affecting its solubility in organic solvents. The triazine moiety is known for its applications in agrochemicals and pharmaceuticals, often exhibiting biological activity. Additionally, the hydrazine group can participate in various chemical reactions, including oxidation and condensation, making this compound of interest in synthetic chemistry. Its specific applications and behavior in biological systems would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. Overall, [5-(4-ethylphenyl)-1,2,4-triazin-3-yl]hydrazine represents a versatile structure with potential utility in various chemical and medicinal fields.

Formula: C₁₁H₁₃N₅

InChI: InChI=1/C11H13N5/c1-2-8-3-5-9(6-4-8)10-7-13-16-11(14-10)15-12/h3-7H,2,12H2,1H3,(H,14,15,16)

SMILES: CCc1ccc(cc1)c1cnnc(n1)NN