CAS 915924-95-7

1-isobutyl-6-oxo-piperidine-3-carboxylic acid

Description:

1-Isobutyl-6-oxo-piperidine-3-carboxylic acid is a chemical compound characterized by its piperidine ring structure, which includes a carboxylic acid functional group and a ketone group. The presence of the isobutyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound typically exhibits moderate polarity due to the carboxylic acid, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The piperidine ring provides a cyclic amine structure, which can affect the compound's biological activity and potential applications in pharmaceuticals or agrochemicals. Additionally, the specific arrangement of substituents on the piperidine ring can lead to unique stereochemical properties, impacting its interactions with biological targets. Overall, 1-isobutyl-6-oxo-piperidine-3-carboxylic acid is of interest in various fields, including medicinal chemistry, due to its potential as a building block for more complex molecules or as a lead compound in drug development.

Formula: C₁₀H₁₇NO₃

InChI: InChI=1/C10H17NO3/c1-7(2)5-11-6-8(10(13)14)3-4-9(11)12/h7-8H,3-6H2,1-2H3,(H,13,14)