CAS 915925-33-6

N-[(5-isobutyl-1,2,4-oxadiazol-3-yl)methyl]ethanamine

Description:

N-[(5-isobutyl-1,2,4-oxadiazol-3-yl)methyl]ethanamine is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and an ethylamine moiety. The presence of the isobutyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The oxadiazole ring is known for its stability and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. The amine functional group suggests potential for hydrogen bonding, which may enhance its reactivity and interaction with other molecules. This compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Its CAS number, 915925-33-6, allows for precise identification and retrieval of information regarding its synthesis, safety data, and applications in research. Overall, this compound's structural features suggest it could be a valuable candidate for further study in various chemical and biological contexts.

Formula: C₉H₁₇N₃O

InChI: InChI=1/C9H17N3O/c1-4-10-6-8-11-9(13-12-8)5-7(2)3/h7,10H,4-6H2,1-3H3

SMILES: CCNCc1nc(CC(C)C)on1

Synonyms:

• 1,2,4-oxadiazole-3-methanamine, N-ethyl-5-(2-methylpropyl)-

N-[(5-isobutyl-1,2,4-oxadiazol-3-yl)methyl]ethanamine

CAS: 915925-33-6

Formula: C₉H₁₇N₃O

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 183.255

Ref: 10-F309747