CymitQuimica logo

CAS 915925-39-2

:

3-(chloromethyl)-5-cyclopentyl-1,2,4-oxadiazole

Description:
3-(Chloromethyl)-5-cyclopentyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring structure. The compound features a chloromethyl group (-CH2Cl) at the 3-position and a cyclopentyl group at the 5-position of the oxadiazole ring, contributing to its unique chemical properties. This structure imparts specific reactivity, particularly in nucleophilic substitution reactions due to the presence of the chloromethyl group. The oxadiazole moiety is known for its potential applications in pharmaceuticals, agrochemicals, and materials science, often exhibiting biological activity and serving as a scaffold for drug development. The compound's physical properties, such as solubility and melting point, can vary based on its molecular interactions and the presence of functional groups. Overall, 3-(chloromethyl)-5-cyclopentyl-1,2,4-oxadiazole represents a versatile compound with potential applications in various fields of chemistry and material science.
Formula:C8H11ClN2O
InChI:InChI=1/C8H11ClN2O/c9-5-7-10-8(12-11-7)6-3-1-2-4-6/h6H,1-5H2
SMILES:C1CCC(C1)c1nc(CCl)no1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.