CAS 91596-61-1

1-(piperidin-4-yl)pyrrolidin-2-one

Description:

1-(Piperidin-4-yl)pyrrolidin-2-one, also known by its CAS number 91596-61-1, is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring and a piperidine moiety. This compound typically exhibits properties associated with both cyclic amines and lactams, contributing to its potential biological activity. It is a white to off-white solid at room temperature and is soluble in polar organic solvents. The presence of nitrogen atoms in its structure may impart basicity, allowing it to interact with various biological targets. This compound has garnered interest in medicinal chemistry for its potential applications in drug development, particularly in the fields of neuropharmacology and as a scaffold for synthesizing more complex molecules. Its specific reactivity and interactions can vary based on the functional groups present and the conditions under which it is used. As with many chemical substances, safety and handling precautions should be observed, given its potential biological effects.

Formula: C₉H₁₆N₂O

InChI: InChI=1/C9H16N2O/c12-9-2-1-7-11(9)8-3-5-10-6-4-8/h8,10H,1-7H2

SMILES: C1CC(=O)N(C1)C1CCNCC1

Synonyms:

• 2-Pyrrolidinone, 1-(4-Piperidinyl)-
• 1-(Piperidin-4-yl)pyrrolidin-2-one

1-PIPERIDIN-4-YLPYRROLIDIN-2-ONE

CAS: 91596-61-1

Formula: C₉H₁₆N₂O

Purity: 95%

Molecular weight: 168.2361

Ref: IN-DA00GUIW

1-Piperidin-4-yl-pyrrolidin-2-one

CAS: 91596-61-1

Formula: C₉H₁₆N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 168.24

Ref: 10-F076468