CAS 91598-91-3

N-(6-hydroxypyren-1-yl)acetamide

Description:

N-(6-hydroxypyren-1-yl)acetamide is an organic compound characterized by its pyrene-derived structure, which includes a hydroxyl group at the 6-position and an acetamide functional group. This compound exhibits properties typical of polycyclic aromatic hydrocarbons, such as fluorescence, making it useful in various applications, including fluorescence microscopy and as a probe in biochemical assays. The presence of the hydroxyl group enhances its solubility in polar solvents and can influence its reactivity, particularly in hydrogen bonding and interactions with other biomolecules. Additionally, the acetamide moiety contributes to its stability and potential for forming hydrogen bonds, which can affect its biological activity and interactions. The compound's unique structure allows it to participate in various chemical reactions, making it of interest in synthetic organic chemistry and materials science. Overall, N-(6-hydroxypyren-1-yl)acetamide is notable for its potential applications in research and industry, particularly in fields related to biochemistry and photonics.

Formula: C₁₈H₁₃NO₂

InChI: InChI=1/C18H13NO2/c1-10(20)19-15-8-4-11-3-7-14-16(21)9-5-12-2-6-13(15)17(11)18(12)14/h2-9,21H,1H3,(H,19,20)

SMILES: CC(=Nc1ccc2ccc3c(ccc4ccc1c2c34)O)O

Synonyms:

• acetamide, N-(6-hydroxy-1-pyrenyl)-

6-Hydroxy-N-Acetyl-1-Aminopyrene

Controlled Product

CAS: 91598-91-3

Formula: C₁₈H₁₃NO₂

Color and Shape: Neat

Molecular weight: 275.301

Ref: TR-H714840