CAS 91598-92-4

N-(8-hydroxypyren-1-yl)acetamide

Description:

N-(8-hydroxypyren-1-yl)acetamide is an organic compound characterized by its pyrene-derived structure, which includes a hydroxyl group at the 8-position and an acetamide functional group. This compound exhibits notable fluorescence properties due to the presence of the pyrene moiety, making it useful in various applications such as fluorescence microscopy and as a fluorescent probe in biochemical assays. The hydroxyl group contributes to its solubility in polar solvents, while the acetamide group enhances its stability and reactivity. Additionally, N-(8-hydroxypyren-1-yl)acetamide can participate in hydrogen bonding, which may influence its interactions with biological molecules. Its unique structural features allow it to serve as a valuable tool in studies involving molecular recognition and sensing. Overall, this compound's combination of optical properties and functional groups makes it significant in both research and potential industrial applications.

Formula: C₁₈H₁₃NO₂

InChI: InChI=1/C18H13NO2/c1-10(20)19-15-8-4-11-2-3-12-5-9-16(21)14-7-6-13(15)17(11)18(12)14/h2-9,21H,1H3,(H,19,20)

SMILES: CC(=Nc1ccc2ccc3ccc(c4ccc1c2c34)O)O

Synonyms:

• acetamide, N-(8-hydroxy-1-pyrenyl)-

8-Hydroxy-N-Acetyl-1-Aminopyrene

Controlled Product

CAS: 91598-92-4

Formula: C₁₈H₁₃NO₂

Color and Shape: Neat

Molecular weight: 275.3

Ref: TR-H714845