CAS 91600-33-8
:ethyl 2-methyl-3-hydroxy-4,4,4-trifluorobutyrate
Description:
Ethyl 2-methyl-3-hydroxy-4,4,4-trifluorobutyrate, with the CAS number 91600-33-8, is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the hydroxy group contributes to its polarity and can participate in hydrogen bonding, affecting its solubility in various solvents. The ethyl ester moiety typically enhances the volatility and reactivity of the compound. Additionally, the methyl group on the second carbon adds to the steric hindrance, which may influence its reactivity and interactions with other molecules. Overall, this compound may exhibit interesting properties in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C7H11F3O3
InChI:InChI=1/C7H11F3O3/c1-3-13-6(12)4(2)5(11)7(8,9)10/h4-5,11H,3H2,1-2H3
SMILES:CCOC(=O)C(C)C(C(F)(F)F)O
Synonyms:- Ethyl 2-methyl-3-hydroxy-4,4,4-trifluorobutyrate~3-Hydroxy-2-methyl-4,4,4-trifluorobutyric acid ethyl ester
- Ethyl 3-hydroxy-2-methyl-4,4,4-trifluorobutyrate
- Ethyl 4,4,4-Trifluoro-3-Hydroxy-2-Methylbutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 4,4,4-trifluoro-3-hydroxy-2-methylbutyrate, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H11F3O3Purity:97%Color and Shape:Clear colorless, LiquidMolecular weight:200.16Ethyl 2-methyl-3-hydroxy-4,4,4-trifluorobutyrate
CAS:Ethyl 2-methyl-3-hydroxy-4,4,4-trifluorobutyratePurity:≥95%Color and Shape:Colourless LiquidMolecular weight:200.16g/mol



