CymitQuimica logo

CAS 916160-42-4

:

4-Chloro-2-methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid

Description:
4-Chloro-2-methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at various positions. The presence of a chloro group at the 4-position, a methoxy group at the 2-position, and a trifluoromethyl group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical reactions. Additionally, the compound may exhibit specific reactivity patterns due to the electron-withdrawing effects of the trifluoromethyl and chloro substituents, which can affect its acidity and nucleophilicity. Overall, this compound's structural features make it a valuable candidate for further studies in medicinal chemistry and material science.
Formula:C8H5ClF3NO3
InChI:InChI=1S/C8H5ClF3NO3/c1-16-6-5(7(14)15)3(9)2-4(13-6)8(10,11)12/h2H,1H3,(H,14,15)
InChI key:InChIKey=PATXWFLMHHOMRX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)N=C(C(F)(F)F)C=C1Cl
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-chloro-2-methoxy-6-(trifluoromethyl)-
  • 4-Chloro-2-methoxy-6-(trifluoromethyl)nicotinic acid
  • 4-Chloro-2-methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.